C23H26N2O4S — CID 10502547
(2S,5R)-5-(3-methylphenyl)-1-[2-[[(2S)-3-phenyl-2-sulfanylpropanoyl]amino]acetyl]pyrrolidine-2-carboxylic acid (PubChem CID 10502547) has the molecular formula C23H26N2O4S and a molecular weight of 426.54 g/mol. Its IUPAC name is (2S,5R)-5-(3-methylphenyl)-1-[2-[[(2S)-3-phenyl-2-sulfanylpropanoyl]amino]acetyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,5R)-5-(3-methylphenyl)-1-[2-[[(2S)-3-phenyl-2-sulfanylpropanoyl]amino]acetyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 10502547 |
| Molecular Formula | C23H26N2O4S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | (2S,5R)-5-(3-methylphenyl)-1-[2-[[(2S)-3-phenyl-2-sulfanylpropanoyl]amino]acetyl]pyrrolidine-2-carboxylic acid |
| SMILES | Cc1cccc([C@H]2CC[C@@H](C(=O)O)N2C(=O)CNC(=O)[C@@H](S)Cc2ccccc2)c1 |
| InChI | InChI=1S/C23H26N2O4S/c1-15-6-5-9-17(12-15)18-10-11-19(23(28)29)25(18)21(26)14-24-22(27)20(30)13-16-7-3-2-4-8-16/h2-9,12,18-20,30H,10-11,13-14H2,1H3,(H,24,27)(H,28,29)/t18-,19+,20+/m1/s1 |
| InChIKey | MUUFSQHEJSEUOA-AABGKKOBSA-N |
| XLogP | 2.77 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|