C22H23ClN2O5S — CID 74994073
1-[2-[[3-(4-chlorophenyl)-2-sulfanylpropanoyl]amino]acetyl]-5-(2-hydroxyphenyl)pyrrolidine-2-carboxylic acid (PubChem CID 74994073) has the molecular formula C22H23ClN2O5S and a molecular weight of 462.96 g/mol. Its IUPAC name is 1-[2-[[3-(4-chlorophenyl)-2-sulfanylpropanoyl]amino]acetyl]-5-(2-hydroxyphenyl)pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[2-[[3-(4-chlorophenyl)-2-sulfanylpropanoyl]amino]acetyl]-5-(2-hydroxyphenyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 74994073 |
| Molecular Formula | C22H23ClN2O5S |
| Molecular Weight | 462.96 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | 1-[2-[[3-(4-chlorophenyl)-2-sulfanylpropanoyl]amino]acetyl]-5-(2-hydroxyphenyl)pyrrolidine-2-carboxylic acid |
| SMILES | O=C(NCC(=O)N1C(C(=O)O)CCC1c1ccccc1O)C(S)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H23ClN2O5S/c23-14-7-5-13(6-8-14)11-19(31)21(28)24-12-20(27)25-16(9-10-17(25)22(29)30)15-3-1-2-4-18(15)26/h1-8,16-17,19,26,31H,9-12H2,(H,24,28)(H,29,30) |
| InChIKey | GRBDVLQGSAADPT-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.96 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|