C24H20ClNO4 — CID 141379002
5-(2-chlorophenyl)-1-(2-hydroxy-6-phenylbenzoyl)pyrrolidine-2-carboxylic acid (PubChem CID 141379002) has the molecular formula C24H20ClNO4 and a molecular weight of 421.88 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-1-(2-hydroxy-6-phenylbenzoyl)pyrrolidine-2-carboxylic acid.
| Compound Name | 5-(2-chlorophenyl)-1-(2-hydroxy-6-phenylbenzoyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 141379002 |
| Molecular Formula | C24H20ClNO4 |
| Molecular Weight | 421.88 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | 5-(2-chlorophenyl)-1-(2-hydroxy-6-phenylbenzoyl)pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCC(c2ccccc2Cl)N1C(=O)c1c(O)cccc1-c1ccccc1 |
| InChI | InChI=1S/C24H20ClNO4/c25-18-11-5-4-9-17(18)19-13-14-20(24(29)30)26(19)23(28)22-16(10-6-12-21(22)27)15-7-2-1-3-8-15/h1-12,19-20,27H,13-14H2,(H,29,30) |
| InChIKey | YVJJLERLCZLYOR-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.88 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |