C25H22ClN3O3 — CID 141378936
1-(2-carbamimidoyl-6-phenylbenzoyl)-5-(2-chlorophenyl)pyrrolidine-2-carboxylic acid (PubChem CID 141378936) has the molecular formula C25H22ClN3O3 and a molecular weight of 447.92 g/mol. Its IUPAC name is 1-(2-carbamimidoyl-6-phenylbenzoyl)-5-(2-chlorophenyl)pyrrolidine-2-carboxylic acid.
| Compound Name | 1-(2-carbamimidoyl-6-phenylbenzoyl)-5-(2-chlorophenyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 141378936 |
| Molecular Formula | C25H22ClN3O3 |
| Molecular Weight | 447.92 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | 1-(2-carbamimidoyl-6-phenylbenzoyl)-5-(2-chlorophenyl)pyrrolidine-2-carboxylic acid |
| SMILES | [H]/N=C(\N)c1cccc(-c2ccccc2)c1C(=O)N1C(C(=O)O)CCC1c1ccccc1Cl |
| InChI | InChI=1S/C25H22ClN3O3/c26-19-12-5-4-9-17(19)20-13-14-21(25(31)32)29(20)24(30)22-16(15-7-2-1-3-8-15)10-6-11-18(22)23(27)28/h1-12,20-21H,13-14H2,(H3,27,28)(H,31,32) |
| InChIKey | AFVBAAHPYZRILJ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.92 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|