About 5-(2-chlorophenyl)-1-(2,3-dimethoxy-6-phenylbenzoyl)pyrrolidine-2-carboxylic acid
5-(2-chlorophenyl)-1-(2,3-dimethoxy-6-phenylbenzoyl)pyrrolidine-2-carboxylic acid (PubChem CID 141378933) has the molecular formula C26H24ClNO5
and a molecular weight of 465.93 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-1-(2,3-dimethoxy-6-phenylbenzoyl)pyrrolidine-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-(2-chlorophenyl)-1-(2,3-dimethoxy-6-phenylbenzoyl)pyrrolidine-2-carboxylic acid |
| PubChem CID | 141378933 |
| Molecular Formula | C26H24ClNO5 |
| Molecular Weight | 465.93 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | 5-(2-chlorophenyl)-1-(2,3-dimethoxy-6-phenylbenzoyl)pyrrolidine-2-carboxylic acid |
| SMILES | COc1ccc(-c2ccccc2)c(C(=O)N2C(C(=O)O)CCC2c2ccccc2Cl)c1OC |
| InChI | InChI=1S/C26H24ClNO5/c1-32-22-15-12-17(16-8-4-3-5-9-16)23(24(22)33-2)25(29)28-20(13-14-21(28)26(30)31)18-10-6-7-11-19(18)27/h3-12,15,20-21H,13-14H2,1-2H3,(H,30,31) |
| InChIKey | QQZHFYNHTJLHBN-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 465.93 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(2-chlorophenyl)-1-(2,3-dimethoxy-6-phenylbenzoyl)pyrrolidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-chlorophenyl)-1-(2,3-dimethoxy-6-phenylbenzoyl)pyrrolidine-2-carboxylic acid?
The IUPAC name of 5-(2-chlorophenyl)-1-(2,3-dimethoxy-6-phenylbenzoyl)pyrrolidine-2-carboxylic acid (CID 141378933) is 5-(2-chlorophenyl)-1-(2,3-dimethoxy-6-phenylbenzoyl)pyrrolidine-2-carboxylic acid.
What is the SMILES notation for 5-(2-chlorophenyl)-1-(2,3-dimethoxy-6-phenylbenzoyl)pyrrolidine-2-carboxylic acid?
The canonical SMILES for 5-(2-chlorophenyl)-1-(2,3-dimethoxy-6-phenylbenzoyl)pyrrolidine-2-carboxylic acid is COc1ccc(-c2ccccc2)c(C(=O)N2C(C(=O)O)CCC2c2ccccc2Cl)c1OC.
What is the InChIKey of 5-(2-chlorophenyl)-1-(2,3-dimethoxy-6-phenylbenzoyl)pyrrolidine-2-carboxylic acid?
The InChIKey is QQZHFYNHTJLHBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H24ClNO5/c1-32-22-15-12-17(16-8-4-3-5-9-16)23(24(22)33-2)25(29)28-20(13-14-21(28)26(30)31)18-10-6-7-11-19(18)27/h3-12,15,20-21H,13-14H2,1-2H3,(H,30,31).
What are the key properties of 5-(2-chlorophenyl)-1-(2,3-dimethoxy-6-phenylbenzoyl)pyrrolidine-2-carboxylic acid?
5-(2-chlorophenyl)-1-(2,3-dimethoxy-6-phenylbenzoyl)pyrrolidine-2-carboxylic acid has a molecular weight of 465.93 g/mol, XLogP of 5.45, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-chlorophenyl)-1-(2,3-dimethoxy-6-phenylbenzoyl)pyrrolidine-2-carboxylic acid is sourced from PubChem (CID 141378933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).