C21H21NO5S — CID 57072381
5-(2-hydroxyphenyl)-1-(4-hydroxy-4-phenyl-3-sulfanylidenebutanoyl)pyrrolidine-2-carboxylic acid (PubChem CID 57072381) has the molecular formula C21H21NO5S and a molecular weight of 399.47 g/mol. Its IUPAC name is 5-(2-hydroxyphenyl)-1-(4-hydroxy-4-phenyl-3-sulfanylidenebutanoyl)pyrrolidine-2-carboxylic acid.
| Compound Name | 5-(2-hydroxyphenyl)-1-(4-hydroxy-4-phenyl-3-sulfanylidenebutanoyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 57072381 |
| Molecular Formula | C21H21NO5S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | 5-(2-hydroxyphenyl)-1-(4-hydroxy-4-phenyl-3-sulfanylidenebutanoyl)pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCC(c2ccccc2O)N1C(=O)CC(=S)C(O)c1ccccc1 |
| InChI | InChI=1S/C21H21NO5S/c23-17-9-5-4-8-14(17)15-10-11-16(21(26)27)22(15)19(24)12-18(28)20(25)13-6-2-1-3-7-13/h1-9,15-16,20,23,25H,10-12H2,(H,26,27) |
| InChIKey | NJGKKAMHAFFLBK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|