C16H18Br2N2O — CID 105026527
N-[(2,5-dibromophenyl)-(5-ethoxy-3-pyridinyl)methyl]ethanamine (PubChem CID 105026527) has the molecular formula C16H18Br2N2O and a molecular weight of 414.14 g/mol. Its IUPAC name is N-[(2,5-dibromophenyl)-(5-ethoxy-3-pyridinyl)methyl]ethanamine.
| Compound Name | N-[(2,5-dibromophenyl)-(5-ethoxy-3-pyridinyl)methyl]ethanamine |
|---|---|
| PubChem CID | 105026527 |
| Molecular Formula | C16H18Br2N2O |
| Molecular Weight | 414.14 g/mol |
| Exact Mass | 411.98 |
| IUPAC Name | N-[(2,5-dibromophenyl)-(5-ethoxy-3-pyridinyl)methyl]ethanamine |
| SMILES | CCNC(c1cncc(OCC)c1)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C16H18Br2N2O/c1-3-20-16(14-8-12(17)5-6-15(14)18)11-7-13(21-4-2)10-19-9-11/h5-10,16,20H,3-4H2,1-2H3 |
| InChIKey | YEOLQYVHMPGYCO-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.14 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |