C17H24N2OS — CID 105027467
N-[(5-ethylthiophen-2-yl)-(5-propan-2-yloxy-3-pyridinyl)methyl]ethanamine (PubChem CID 105027467) has the molecular formula C17H24N2OS and a molecular weight of 304.46 g/mol. Its IUPAC name is N-[(5-ethylthiophen-2-yl)-(5-propan-2-yloxy-3-pyridinyl)methyl]ethanamine.
| Compound Name | N-[(5-ethylthiophen-2-yl)-(5-propan-2-yloxy-3-pyridinyl)methyl]ethanamine |
|---|---|
| PubChem CID | 105027467 |
| Molecular Formula | C17H24N2OS |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | N-[(5-ethylthiophen-2-yl)-(5-propan-2-yloxy-3-pyridinyl)methyl]ethanamine |
| SMILES | CCNC(c1cncc(OC(C)C)c1)c1ccc(CC)s1 |
| InChI | InChI=1S/C17H24N2OS/c1-5-15-7-8-16(21-15)17(19-6-2)13-9-14(11-18-10-13)20-12(3)4/h7-12,17,19H,5-6H2,1-4H3 |
| InChIKey | UGDYAVHIRUXUCI-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |