C15H19FN2S — CID 115804512
N-[(5-ethylthiophen-2-yl)-(5-fluoro-3-pyridinyl)methyl]propan-1-amine (PubChem CID 115804512) has the molecular formula C15H19FN2S and a molecular weight of 278.40 g/mol. Its IUPAC name is N-[(5-ethylthiophen-2-yl)-(5-fluoro-3-pyridinyl)methyl]propan-1-amine.
| Compound Name | N-[(5-ethylthiophen-2-yl)-(5-fluoro-3-pyridinyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 115804512 |
| Molecular Formula | C15H19FN2S |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | N-[(5-ethylthiophen-2-yl)-(5-fluoro-3-pyridinyl)methyl]propan-1-amine |
| SMILES | CCCNC(c1cncc(F)c1)c1ccc(CC)s1 |
| InChI | InChI=1S/C15H19FN2S/c1-3-7-18-15(11-8-12(16)10-17-9-11)14-6-5-13(4-2)19-14/h5-6,8-10,15,18H,3-4,7H2,1-2H3 |
| InChIKey | DZOKQDVOJNLQPW-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |