C18H37N — CID 105027808
1-cycloheptyl-N-ethyl-3,5,5-trimethylhexan-1-amine (PubChem CID 105027808) has the molecular formula C18H37N and a molecular weight of 267.50 g/mol. Its IUPAC name is 1-cycloheptyl-N-ethyl-3,5,5-trimethylhexan-1-amine.
| Compound Name | 1-cycloheptyl-N-ethyl-3,5,5-trimethylhexan-1-amine |
|---|---|
| PubChem CID | 105027808 |
| Molecular Formula | C18H37N |
| Molecular Weight | 267.50 g/mol |
| Exact Mass | 267.29 |
| IUPAC Name | 1-cycloheptyl-N-ethyl-3,5,5-trimethylhexan-1-amine |
| SMILES | CCNC(CC(C)CC(C)(C)C)C1CCCCCC1 |
| InChI | InChI=1S/C18H37N/c1-6-19-17(13-15(2)14-18(3,4)5)16-11-9-7-8-10-12-16/h15-17,19H,6-14H2,1-5H3 |
| InChIKey | AQGDATKLFBRKRI-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.50 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |