C15H32N2 — CID 105282017
(1-cyclohexyl-3,5,5-trimethylhexyl)hydrazine (PubChem CID 105282017) has the molecular formula C15H32N2 and a molecular weight of 240.43 g/mol. Its IUPAC name is (1-cyclohexyl-3,5,5-trimethylhexyl)hydrazine.
| Compound Name | (1-cyclohexyl-3,5,5-trimethylhexyl)hydrazine |
|---|---|
| PubChem CID | 105282017 |
| Molecular Formula | C15H32N2 |
| Molecular Weight | 240.43 g/mol |
| Exact Mass | 240.26 |
| IUPAC Name | (1-cyclohexyl-3,5,5-trimethylhexyl)hydrazine |
| SMILES | CC(CC(NN)C1CCCCC1)CC(C)(C)C |
| InChI | InChI=1S/C15H32N2/c1-12(11-15(2,3)4)10-14(17-16)13-8-6-5-7-9-13/h12-14,17H,5-11,16H2,1-4H3 |
| InChIKey | FQPJBTIAJPUXPB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.43 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|