C17H35NO2S — CID 105014333
N,3,5,5-tetramethyl-1-(3-methylsulfonylcyclohexyl)hexan-1-amine (PubChem CID 105014333) has the molecular formula C17H35NO2S and a molecular weight of 317.54 g/mol. Its IUPAC name is N,3,5,5-tetramethyl-1-(3-methylsulfonylcyclohexyl)hexan-1-amine.
| Compound Name | N,3,5,5-tetramethyl-1-(3-methylsulfonylcyclohexyl)hexan-1-amine |
|---|---|
| PubChem CID | 105014333 |
| Molecular Formula | C17H35NO2S |
| Molecular Weight | 317.54 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | N,3,5,5-tetramethyl-1-(3-methylsulfonylcyclohexyl)hexan-1-amine |
| SMILES | CNC(CC(C)CC(C)(C)C)C1CCCC(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C17H35NO2S/c1-13(12-17(2,3)4)10-16(18-5)14-8-7-9-15(11-14)21(6,19)20/h13-16,18H,7-12H2,1-6H3 |
| InChIKey | WAIUJMCQILUDRJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.54 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |