C15H33N3O2S — CID 105239337
N,N-diethyl-1-hydrazinyl-2-methyl-1-(3-methylsulfonylcyclohexyl)propan-2-amine (PubChem CID 105239337) has the molecular formula C15H33N3O2S and a molecular weight of 319.52 g/mol. Its IUPAC name is N,N-diethyl-1-hydrazinyl-2-methyl-1-(3-methylsulfonylcyclohexyl)propan-2-amine.
| Compound Name | N,N-diethyl-1-hydrazinyl-2-methyl-1-(3-methylsulfonylcyclohexyl)propan-2-amine |
|---|---|
| PubChem CID | 105239337 |
| Molecular Formula | C15H33N3O2S |
| Molecular Weight | 319.52 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | N,N-diethyl-1-hydrazinyl-2-methyl-1-(3-methylsulfonylcyclohexyl)propan-2-amine |
| SMILES | CCN(CC)C(C)(C)C(NN)C1CCCC(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C15H33N3O2S/c1-6-18(7-2)15(3,4)14(17-16)12-9-8-10-13(11-12)21(5,19)20/h12-14,17H,6-11,16H2,1-5H3 |
| InChIKey | KTRJTXKHCFUKQU-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.52 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|