C12H27N3 — CID 105239402
1-cyclobutyl-N,N-diethyl-1-hydrazinyl-2-methylpropan-2-amine (PubChem CID 105239402) has the molecular formula C12H27N3 and a molecular weight of 213.37 g/mol. Its IUPAC name is 1-cyclobutyl-N,N-diethyl-1-hydrazinyl-2-methylpropan-2-amine.
| Compound Name | 1-cyclobutyl-N,N-diethyl-1-hydrazinyl-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 105239402 |
| Molecular Formula | C12H27N3 |
| Molecular Weight | 213.37 g/mol |
| Exact Mass | 213.22 |
| IUPAC Name | 1-cyclobutyl-N,N-diethyl-1-hydrazinyl-2-methylpropan-2-amine |
| SMILES | CCN(CC)C(C)(C)C(NN)C1CCC1 |
| InChI | InChI=1S/C12H27N3/c1-5-15(6-2)12(3,4)11(14-13)10-8-7-9-10/h10-11,14H,5-9,13H2,1-4H3 |
| InChIKey | TVZGVZOHHTWYCI-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.37 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|