C9H17NO4S — CID 106702897
(2R)-2-amino-2-(3-methylsulfonylcyclohexyl)acetic acid (PubChem CID 106702897) has the molecular formula C9H17NO4S and a molecular weight of 235.30 g/mol. Its IUPAC name is (2R)-2-amino-2-(3-methylsulfonylcyclohexyl)acetic acid.
| Compound Name | (2R)-2-amino-2-(3-methylsulfonylcyclohexyl)acetic acid |
|---|---|
| PubChem CID | 106702897 |
| Molecular Formula | C9H17NO4S |
| Molecular Weight | 235.30 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | (2R)-2-amino-2-(3-methylsulfonylcyclohexyl)acetic acid |
| SMILES | CS(=O)(=O)C1CCCC([C@@H](N)C(=O)O)C1 |
| InChI | InChI=1S/C9H17NO4S/c1-15(13,14)7-4-2-3-6(5-7)8(10)9(11)12/h6-8H,2-5,10H2,1H3,(H,11,12)/t6?,7?,8-/m1/s1 |
| InChIKey | JQVHCAXSYHCFQC-KAVNDROISA-N |
| XLogP | 0.00 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.30 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |