C12H24O4S — CID 103455003
1-(3-methylsulfonylcyclohexyl)pentane-1,2-diol (PubChem CID 103455003) has the molecular formula C12H24O4S and a molecular weight of 264.39 g/mol. Its IUPAC name is 1-(3-methylsulfonylcyclohexyl)pentane-1,2-diol.
| Compound Name | 1-(3-methylsulfonylcyclohexyl)pentane-1,2-diol |
|---|---|
| PubChem CID | 103455003 |
| Molecular Formula | C12H24O4S |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 1-(3-methylsulfonylcyclohexyl)pentane-1,2-diol |
| SMILES | CCCC(O)C(O)C1CCCC(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C12H24O4S/c1-3-5-11(13)12(14)9-6-4-7-10(8-9)17(2,15)16/h9-14H,3-8H2,1-2H3 |
| InChIKey | NNLFHLVMVBNNGE-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |