C9H18O2 — CID 103454869
1-cyclobutylpentane-1,2-diol (PubChem CID 103454869) has the molecular formula C9H18O2 and a molecular weight of 158.24 g/mol. Its IUPAC name is 1-cyclobutylpentane-1,2-diol.
| Compound Name | 1-cyclobutylpentane-1,2-diol |
|---|---|
| PubChem CID | 103454869 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | 1-cyclobutylpentane-1,2-diol |
| SMILES | CCCC(O)C(O)C1CCC1 |
| InChI | InChI=1S/C9H18O2/c1-2-4-8(10)9(11)7-5-3-6-7/h7-11H,2-6H2,1H3 |
| InChIKey | WJOVSZZYOKIJEK-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |