C27H33N3O2 — CID 10502821
(2S)-N-[(4-aminocyclohexyl)methyl]-1-[2-(9H-fluoren-9-yl)acetyl]pyrrolidine-2-carboxamide (PubChem CID 10502821) has the molecular formula C27H33N3O2 and a molecular weight of 431.58 g/mol. Its IUPAC name is (2S)-N-[(4-aminocyclohexyl)methyl]-1-[2-(9H-fluoren-9-yl)acetyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(4-aminocyclohexyl)methyl]-1-[2-(9H-fluoren-9-yl)acetyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 10502821 |
| Molecular Formula | C27H33N3O2 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | (2S)-N-[(4-aminocyclohexyl)methyl]-1-[2-(9H-fluoren-9-yl)acetyl]pyrrolidine-2-carboxamide |
| SMILES | NC1CCC(CNC(=O)[C@@H]2CCCN2C(=O)CC2c3ccccc3-c3ccccc32)CC1 |
| InChI | InChI=1S/C27H33N3O2/c28-19-13-11-18(12-14-19)17-29-27(32)25-10-5-15-30(25)26(31)16-24-22-8-3-1-6-20(22)21-7-2-4-9-23(21)24/h1-4,6-9,18-19,24-25H,5,10-17,28H2,(H,29,32)/t18?,19?,25-/m0/s1 |
| InChIKey | AQEUHBJRRKZFBK-BRVOVERQSA-N |
| XLogP | 3.81 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |