C34H49N3O2 — CID 25053421
(2S)-2-acetamido-N-methyl-3-phenyl-N-[(1R,2S,5S,6S,9R,12S,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]propanamide (PubChem CID 25053421) has the molecular formula C34H49N3O2 and a molecular weight of 531.79 g/mol. Its IUPAC name is (2S)-2-acetamido-N-methyl-3-phenyl-N-[(1R,2S,5S,6S,9R,12S,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]propanamide.
| Compound Name | (2S)-2-acetamido-N-methyl-3-phenyl-N-[(1R,2S,5S,6S,9R,12S,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]propanamide |
|---|---|
| PubChem CID | 25053421 |
| Molecular Formula | C34H49N3O2 |
| Molecular Weight | 531.79 g/mol |
| Exact Mass | 531.38 |
| IUPAC Name | (2S)-2-acetamido-N-methyl-3-phenyl-N-[(1R,2S,5S,6S,9R,12S,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]propanamide |
| SMILES | CC(=O)N[C@@H](Cc1ccccc1)C(=O)N(C)[C@H]1CC[C@@]2(C)C(=CC[C@H]3[C@@H]4CC[C@@H]5[C@H](C)N(C)C[C@@]54CC[C@@H]32)C1 |
| InChI | InChI=1S/C34H49N3O2/c1-22-28-13-14-30-27-12-11-25-20-26(15-17-33(25,3)29(27)16-18-34(28,30)21-36(22)4)37(5)32(39)31(35-23(2)38)19-24-9-7-6-8-10-24/h6-11,22,26-31H,12-21H2,1-5H3,(H,35,38)/t22-,26-,27+,28+,29-,30-,31-,33-,34-/m0/s1 |
| InChIKey | XUMAXPIIUJYLNX-OLFWIATPSA-N |
| XLogP | 5.45 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.79 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|