C14H25NS — CID 105028432
N,3-diethyl-1-(5-methylthiophen-2-yl)pentan-1-amine (PubChem CID 105028432) has the molecular formula C14H25NS and a molecular weight of 239.43 g/mol. Its IUPAC name is N,3-diethyl-1-(5-methylthiophen-2-yl)pentan-1-amine.
| Compound Name | N,3-diethyl-1-(5-methylthiophen-2-yl)pentan-1-amine |
|---|---|
| PubChem CID | 105028432 |
| Molecular Formula | C14H25NS |
| Molecular Weight | 239.43 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | N,3-diethyl-1-(5-methylthiophen-2-yl)pentan-1-amine |
| SMILES | CCNC(CC(CC)CC)c1ccc(C)s1 |
| InChI | InChI=1S/C14H25NS/c1-5-12(6-2)10-13(15-7-3)14-9-8-11(4)16-14/h8-9,12-13,15H,5-7,10H2,1-4H3 |
| InChIKey | WCFXAHYFVKRMJV-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.43 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |