C15H18FNS2 — CID 66066896
N-ethyl-2-(4-fluorophenyl)sulfanyl-1-(5-methylthiophen-2-yl)ethanamine (PubChem CID 66066896) has the molecular formula C15H18FNS2 and a molecular weight of 295.45 g/mol. Its IUPAC name is N-ethyl-2-(4-fluorophenyl)sulfanyl-1-(5-methylthiophen-2-yl)ethanamine.
| Compound Name | N-ethyl-2-(4-fluorophenyl)sulfanyl-1-(5-methylthiophen-2-yl)ethanamine |
|---|---|
| PubChem CID | 66066896 |
| Molecular Formula | C15H18FNS2 |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | N-ethyl-2-(4-fluorophenyl)sulfanyl-1-(5-methylthiophen-2-yl)ethanamine |
| SMILES | CCNC(CSc1ccc(F)cc1)c1ccc(C)s1 |
| InChI | InChI=1S/C15H18FNS2/c1-3-17-14(15-9-4-11(2)19-15)10-18-13-7-5-12(16)6-8-13/h4-9,14,17H,3,10H2,1-2H3 |
| InChIKey | AHOHYKBRMXNTDA-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |