C19H35N — CID 105028573
N,5-dimethyl-1-(3-methyl-1-adamantyl)hexan-1-amine (PubChem CID 105028573) has the molecular formula C19H35N and a molecular weight of 277.50 g/mol. Its IUPAC name is N,5-dimethyl-1-(3-methyl-1-adamantyl)hexan-1-amine.
| Compound Name | N,5-dimethyl-1-(3-methyl-1-adamantyl)hexan-1-amine |
|---|---|
| PubChem CID | 105028573 |
| Molecular Formula | C19H35N |
| Molecular Weight | 277.50 g/mol |
| Exact Mass | 277.28 |
| IUPAC Name | N,5-dimethyl-1-(3-methyl-1-adamantyl)hexan-1-amine |
| SMILES | CNC(CCCC(C)C)C12CC3CC(CC(C)(C3)C1)C2 |
| InChI | InChI=1S/C19H35N/c1-14(2)6-5-7-17(20-4)19-11-15-8-16(12-19)10-18(3,9-15)13-19/h14-17,20H,5-13H2,1-4H3 |
| InChIKey | MRXGUNOXNYJTSF-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.50 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |