C14H22IN — CID 105028957
1-(3-iodophenyl)-N,5-dimethylhexan-1-amine (PubChem CID 105028957) has the molecular formula C14H22IN and a molecular weight of 331.24 g/mol. Its IUPAC name is 1-(3-iodophenyl)-N,5-dimethylhexan-1-amine.
| Compound Name | 1-(3-iodophenyl)-N,5-dimethylhexan-1-amine |
|---|---|
| PubChem CID | 105028957 |
| Molecular Formula | C14H22IN |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 1-(3-iodophenyl)-N,5-dimethylhexan-1-amine |
| SMILES | CNC(CCCC(C)C)c1cccc(I)c1 |
| InChI | InChI=1S/C14H22IN/c1-11(2)6-4-9-14(16-3)12-7-5-8-13(15)10-12/h5,7-8,10-11,14,16H,4,6,9H2,1-3H3 |
| InChIKey | UWSVLORFHMESAO-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|