C12H18IN — CID 105017535
1-(3-iodophenyl)-N,2-dimethylbutan-1-amine (PubChem CID 105017535) has the molecular formula C12H18IN and a molecular weight of 303.19 g/mol. Its IUPAC name is 1-(3-iodophenyl)-N,2-dimethylbutan-1-amine.
| Compound Name | 1-(3-iodophenyl)-N,2-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 105017535 |
| Molecular Formula | C12H18IN |
| Molecular Weight | 303.19 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 1-(3-iodophenyl)-N,2-dimethylbutan-1-amine |
| SMILES | CCC(C)C(NC)c1cccc(I)c1 |
| InChI | InChI=1S/C12H18IN/c1-4-9(2)12(14-3)10-6-5-7-11(13)8-10/h5-9,12,14H,4H2,1-3H3 |
| InChIKey | KJXXBWFUDXSTJT-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.19 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|