C16H22IN3 — CID 104989834
2-(1-butan-2-ylpyrazol-3-yl)-1-(3-iodophenyl)-N-methylethanamine (PubChem CID 104989834) has the molecular formula C16H22IN3 and a molecular weight of 383.28 g/mol. Its IUPAC name is 2-(1-butan-2-ylpyrazol-3-yl)-1-(3-iodophenyl)-N-methylethanamine.
| Compound Name | 2-(1-butan-2-ylpyrazol-3-yl)-1-(3-iodophenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 104989834 |
| Molecular Formula | C16H22IN3 |
| Molecular Weight | 383.28 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | 2-(1-butan-2-ylpyrazol-3-yl)-1-(3-iodophenyl)-N-methylethanamine |
| SMILES | CCC(C)n1ccc(CC(NC)c2cccc(I)c2)n1 |
| InChI | InChI=1S/C16H22IN3/c1-4-12(2)20-9-8-15(19-20)11-16(18-3)13-6-5-7-14(17)10-13/h5-10,12,16,18H,4,11H2,1-3H3 |
| InChIKey | OKEXRBGSIRBLEQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.28 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|