C16H21BrFN3 — CID 107953147
1-(3-bromo-2-fluorophenyl)-2-(1-butan-2-ylpyrazol-3-yl)-N-methylethanamine (PubChem CID 107953147) has the molecular formula C16H21BrFN3 and a molecular weight of 354.27 g/mol. Its IUPAC name is 1-(3-bromo-2-fluorophenyl)-2-(1-butan-2-ylpyrazol-3-yl)-N-methylethanamine.
| Compound Name | 1-(3-bromo-2-fluorophenyl)-2-(1-butan-2-ylpyrazol-3-yl)-N-methylethanamine |
|---|---|
| PubChem CID | 107953147 |
| Molecular Formula | C16H21BrFN3 |
| Molecular Weight | 354.27 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 1-(3-bromo-2-fluorophenyl)-2-(1-butan-2-ylpyrazol-3-yl)-N-methylethanamine |
| SMILES | CCC(C)n1ccc(CC(NC)c2cccc(Br)c2F)n1 |
| InChI | InChI=1S/C16H21BrFN3/c1-4-11(2)21-9-8-12(20-21)10-15(19-3)13-6-5-7-14(17)16(13)18/h5-9,11,15,19H,4,10H2,1-3H3 |
| InChIKey | DBIHZIPHTYVNCW-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.27 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |