C17H24FN3 — CID 64785502
1-(3-fluorophenyl)-N-methyl-2-(1-pentan-3-ylpyrazol-3-yl)ethanamine (PubChem CID 64785502) has the molecular formula C17H24FN3 and a molecular weight of 289.40 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-N-methyl-2-(1-pentan-3-ylpyrazol-3-yl)ethanamine.
| Compound Name | 1-(3-fluorophenyl)-N-methyl-2-(1-pentan-3-ylpyrazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 64785502 |
| Molecular Formula | C17H24FN3 |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 1-(3-fluorophenyl)-N-methyl-2-(1-pentan-3-ylpyrazol-3-yl)ethanamine |
| SMILES | CCC(CC)n1ccc(CC(NC)c2cccc(F)c2)n1 |
| InChI | InChI=1S/C17H24FN3/c1-4-16(5-2)21-10-9-15(20-21)12-17(19-3)13-7-6-8-14(18)11-13/h6-11,16-17,19H,4-5,12H2,1-3H3 |
| InChIKey | OYRSBJJDWFNSJV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |