C15H22BrN3S — CID 105155766
1-(5-bromothiophen-3-yl)-N-methyl-2-(1-pentan-3-ylpyrazol-3-yl)ethanamine (PubChem CID 105155766) has the molecular formula C15H22BrN3S and a molecular weight of 356.33 g/mol. Its IUPAC name is 1-(5-bromothiophen-3-yl)-N-methyl-2-(1-pentan-3-ylpyrazol-3-yl)ethanamine.
| Compound Name | 1-(5-bromothiophen-3-yl)-N-methyl-2-(1-pentan-3-ylpyrazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 105155766 |
| Molecular Formula | C15H22BrN3S |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | 1-(5-bromothiophen-3-yl)-N-methyl-2-(1-pentan-3-ylpyrazol-3-yl)ethanamine |
| SMILES | CCC(CC)n1ccc(CC(NC)c2csc(Br)c2)n1 |
| InChI | InChI=1S/C15H22BrN3S/c1-4-13(5-2)19-7-6-12(18-19)9-14(17-3)11-8-15(16)20-10-11/h6-8,10,13-14,17H,4-5,9H2,1-3H3 |
| InChIKey | OTTIYTNYFKFTQO-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |