C15H29NO — CID 105033319
1-(3,4-dihydro-2H-pyran-5-yl)decan-1-amine (PubChem CID 105033319) has the molecular formula C15H29NO and a molecular weight of 239.40 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-pyran-5-yl)decan-1-amine.
| Compound Name | 1-(3,4-dihydro-2H-pyran-5-yl)decan-1-amine |
|---|---|
| PubChem CID | 105033319 |
| Molecular Formula | C15H29NO |
| Molecular Weight | 239.40 g/mol |
| Exact Mass | 239.22 |
| IUPAC Name | 1-(3,4-dihydro-2H-pyran-5-yl)decan-1-amine |
| SMILES | CCCCCCCCCC(N)C1=COCCC1 |
| InChI | InChI=1S/C15H29NO/c1-2-3-4-5-6-7-8-11-15(16)14-10-9-12-17-13-14/h13,15H,2-12,16H2,1H3 |
| InChIKey | XPOZJPPETLJVDP-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|