C10H19NO — CID 152961582
4-(5-methyl-3,4-dihydro-2H-pyran-2-yl)butan-1-amine (PubChem CID 152961582) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is 4-(5-methyl-3,4-dihydro-2H-pyran-2-yl)butan-1-amine.
| Compound Name | 4-(5-methyl-3,4-dihydro-2H-pyran-2-yl)butan-1-amine |
|---|---|
| PubChem CID | 152961582 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | 4-(5-methyl-3,4-dihydro-2H-pyran-2-yl)butan-1-amine |
| SMILES | CC1=COC(CCCCN)CC1 |
| InChI | InChI=1S/C10H19NO/c1-9-5-6-10(12-8-9)4-2-3-7-11/h8,10H,2-7,11H2,1H3 |
| InChIKey | UQRFMRHPDWMBID-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|