C16H23N — CID 105033708
N-methyl-1-(2,4,6-trimethylphenyl)hex-5-yn-1-amine (PubChem CID 105033708) has the molecular formula C16H23N and a molecular weight of 229.37 g/mol. Its IUPAC name is N-methyl-1-(2,4,6-trimethylphenyl)hex-5-yn-1-amine.
| Compound Name | N-methyl-1-(2,4,6-trimethylphenyl)hex-5-yn-1-amine |
|---|---|
| PubChem CID | 105033708 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | N-methyl-1-(2,4,6-trimethylphenyl)hex-5-yn-1-amine |
| SMILES | C#CCCCC(NC)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C16H23N/c1-6-7-8-9-15(17-5)16-13(3)10-12(2)11-14(16)4/h1,10-11,15,17H,7-9H2,2-5H3 |
| InChIKey | LBKOPBZDCCOYCG-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|