C13H19N3 — CID 105266423
1-(3,5-dimethyl-2-pyridinyl)hex-5-ynylhydrazine (PubChem CID 105266423) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is 1-(3,5-dimethyl-2-pyridinyl)hex-5-ynylhydrazine.
| Compound Name | 1-(3,5-dimethyl-2-pyridinyl)hex-5-ynylhydrazine |
|---|---|
| PubChem CID | 105266423 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 1-(3,5-dimethyl-2-pyridinyl)hex-5-ynylhydrazine |
| SMILES | C#CCCCC(NN)c1ncc(C)cc1C |
| InChI | InChI=1S/C13H19N3/c1-4-5-6-7-12(16-14)13-11(3)8-10(2)9-15-13/h1,8-9,12,16H,5-7,14H2,2-3H3 |
| InChIKey | DJSRGFWXJWMZMH-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|