C12H20N4 — CID 105333462
1-(2-ethyl-5-methylpyrazol-3-yl)hex-5-ynylhydrazine (PubChem CID 105333462) has the molecular formula C12H20N4 and a molecular weight of 220.32 g/mol. Its IUPAC name is 1-(2-ethyl-5-methylpyrazol-3-yl)hex-5-ynylhydrazine.
| Compound Name | 1-(2-ethyl-5-methylpyrazol-3-yl)hex-5-ynylhydrazine |
|---|---|
| PubChem CID | 105333462 |
| Molecular Formula | C12H20N4 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | 1-(2-ethyl-5-methylpyrazol-3-yl)hex-5-ynylhydrazine |
| SMILES | C#CCCCC(NN)c1cc(C)nn1CC |
| InChI | InChI=1S/C12H20N4/c1-4-6-7-8-11(14-13)12-9-10(3)15-16(12)5-2/h1,9,11,14H,5-8,13H2,2-3H3 |
| InChIKey | OSYKIBYTDSODMS-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|