C14H23BrN6 — CID 105316719
[2-(4-bromo-1-ethyl-3-methylpyrazol-5-yl)-1-(2-ethyl-5-methylpyrazol-3-yl)ethyl]hydrazine (PubChem CID 105316719) has the molecular formula C14H23BrN6 and a molecular weight of 355.28 g/mol. Its IUPAC name is [2-(4-bromo-1-ethyl-3-methylpyrazol-5-yl)-1-(2-ethyl-5-methylpyrazol-3-yl)ethyl]hydrazine.
| Compound Name | [2-(4-bromo-1-ethyl-3-methylpyrazol-5-yl)-1-(2-ethyl-5-methylpyrazol-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105316719 |
| Molecular Formula | C14H23BrN6 |
| Molecular Weight | 355.28 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | [2-(4-bromo-1-ethyl-3-methylpyrazol-5-yl)-1-(2-ethyl-5-methylpyrazol-3-yl)ethyl]hydrazine |
| SMILES | CCn1nc(C)cc1C(Cc1c(Br)c(C)nn1CC)NN |
| InChI | InChI=1S/C14H23BrN6/c1-5-20-12(7-9(3)18-20)11(17-16)8-13-14(15)10(4)19-21(13)6-2/h7,11,17H,5-6,8,16H2,1-4H3 |
| InChIKey | IVGRICBCJVVWOP-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 73.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.28 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|