C14H17BrCl2N4 — CID 105316685
[2-(4-bromo-1-ethyl-3-methylpyrazol-5-yl)-1-(2,5-dichlorophenyl)ethyl]hydrazine (PubChem CID 105316685) has the molecular formula C14H17BrCl2N4 and a molecular weight of 392.13 g/mol. Its IUPAC name is [2-(4-bromo-1-ethyl-3-methylpyrazol-5-yl)-1-(2,5-dichlorophenyl)ethyl]hydrazine.
| Compound Name | [2-(4-bromo-1-ethyl-3-methylpyrazol-5-yl)-1-(2,5-dichlorophenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105316685 |
| Molecular Formula | C14H17BrCl2N4 |
| Molecular Weight | 392.13 g/mol |
| Exact Mass | 390.00 |
| IUPAC Name | [2-(4-bromo-1-ethyl-3-methylpyrazol-5-yl)-1-(2,5-dichlorophenyl)ethyl]hydrazine |
| SMILES | CCn1nc(C)c(Br)c1CC(NN)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H17BrCl2N4/c1-3-21-13(14(15)8(2)20-21)7-12(19-18)10-6-9(16)4-5-11(10)17/h4-6,12,19H,3,7,18H2,1-2H3 |
| InChIKey | YTMPROUJJXTYPL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.13 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|