C12H23N — CID 105033818
N,2,3-trimethylnon-8-yn-4-amine (PubChem CID 105033818) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is N,2,3-trimethylnon-8-yn-4-amine.
| Compound Name | N,2,3-trimethylnon-8-yn-4-amine |
|---|---|
| PubChem CID | 105033818 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | N,2,3-trimethylnon-8-yn-4-amine |
| SMILES | C#CCCCC(NC)C(C)C(C)C |
| InChI | InChI=1S/C12H23N/c1-6-7-8-9-12(13-5)11(4)10(2)3/h1,10-13H,7-9H2,2-5H3 |
| InChIKey | ACLQXTYJSMMIQA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|