C13H17NS2 — CID 105033893
1-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)hex-5-yn-1-amine (PubChem CID 105033893) has the molecular formula C13H17NS2 and a molecular weight of 251.42 g/mol. Its IUPAC name is 1-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)hex-5-yn-1-amine.
| Compound Name | 1-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)hex-5-yn-1-amine |
|---|---|
| PubChem CID | 105033893 |
| Molecular Formula | C13H17NS2 |
| Molecular Weight | 251.42 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 1-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)hex-5-yn-1-amine |
| SMILES | C#CCCCC(N)c1cc2c(s1)CCSC2 |
| InChI | InChI=1S/C13H17NS2/c1-2-3-4-5-11(14)13-8-10-9-15-7-6-12(10)16-13/h1,8,11H,3-7,9,14H2 |
| InChIKey | UHBVXGZYAUQIQG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|