C16H19BrN2 — CID 105034516
1-(3-bromo-2-methylphenyl)-N-ethyl-2-pyridin-3-ylethanamine (PubChem CID 105034516) has the molecular formula C16H19BrN2 and a molecular weight of 319.25 g/mol. Its IUPAC name is 1-(3-bromo-2-methylphenyl)-N-ethyl-2-pyridin-3-ylethanamine.
| Compound Name | 1-(3-bromo-2-methylphenyl)-N-ethyl-2-pyridin-3-ylethanamine |
|---|---|
| PubChem CID | 105034516 |
| Molecular Formula | C16H19BrN2 |
| Molecular Weight | 319.25 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 1-(3-bromo-2-methylphenyl)-N-ethyl-2-pyridin-3-ylethanamine |
| SMILES | CCNC(Cc1cccnc1)c1cccc(Br)c1C |
| InChI | InChI=1S/C16H19BrN2/c1-3-19-16(10-13-6-5-9-18-11-13)14-7-4-8-15(17)12(14)2/h4-9,11,16,19H,3,10H2,1-2H3 |
| InChIKey | CHUAHDAUSBMMOK-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.25 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |