C16H15Br2ClFN — CID 105037839
2-(4-bromo-2-chlorophenyl)-1-(2-bromo-5-fluorophenyl)-N-ethylethanamine (PubChem CID 105037839) has the molecular formula C16H15Br2ClFN and a molecular weight of 435.56 g/mol. Its IUPAC name is 2-(4-bromo-2-chlorophenyl)-1-(2-bromo-5-fluorophenyl)-N-ethylethanamine.
| Compound Name | 2-(4-bromo-2-chlorophenyl)-1-(2-bromo-5-fluorophenyl)-N-ethylethanamine |
|---|---|
| PubChem CID | 105037839 |
| Molecular Formula | C16H15Br2ClFN |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 432.92 |
| IUPAC Name | 2-(4-bromo-2-chlorophenyl)-1-(2-bromo-5-fluorophenyl)-N-ethylethanamine |
| SMILES | CCNC(Cc1ccc(Br)cc1Cl)c1cc(F)ccc1Br |
| InChI | InChI=1S/C16H15Br2ClFN/c1-2-21-16(13-9-12(20)5-6-14(13)18)7-10-3-4-11(17)8-15(10)19/h3-6,8-9,16,21H,2,7H2,1H3 |
| InChIKey | AEFISWLLOOKQKI-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |