C16H15Br2Cl2N — CID 115863189
1-(2,5-dibromophenyl)-2-(2,5-dichlorophenyl)-N-ethylethanamine (PubChem CID 115863189) has the molecular formula C16H15Br2Cl2N and a molecular weight of 452.02 g/mol. Its IUPAC name is 1-(2,5-dibromophenyl)-2-(2,5-dichlorophenyl)-N-ethylethanamine.
| Compound Name | 1-(2,5-dibromophenyl)-2-(2,5-dichlorophenyl)-N-ethylethanamine |
|---|---|
| PubChem CID | 115863189 |
| Molecular Formula | C16H15Br2Cl2N |
| Molecular Weight | 452.02 g/mol |
| Exact Mass | 448.89 |
| IUPAC Name | 1-(2,5-dibromophenyl)-2-(2,5-dichlorophenyl)-N-ethylethanamine |
| SMILES | CCNC(Cc1cc(Cl)ccc1Cl)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C16H15Br2Cl2N/c1-2-21-16(13-9-11(17)3-5-14(13)18)8-10-7-12(19)4-6-15(10)20/h3-7,9,16,21H,2,8H2,1H3 |
| InChIKey | FEKZWCONJWOSJE-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.02 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |