C14H27N — CID 105039581
1-(1-ethylcyclopentyl)-N,4-dimethylpent-4-en-1-amine (PubChem CID 105039581) has the molecular formula C14H27N and a molecular weight of 209.38 g/mol. Its IUPAC name is 1-(1-ethylcyclopentyl)-N,4-dimethylpent-4-en-1-amine.
| Compound Name | 1-(1-ethylcyclopentyl)-N,4-dimethylpent-4-en-1-amine |
|---|---|
| PubChem CID | 105039581 |
| Molecular Formula | C14H27N |
| Molecular Weight | 209.38 g/mol |
| Exact Mass | 209.21 |
| IUPAC Name | 1-(1-ethylcyclopentyl)-N,4-dimethylpent-4-en-1-amine |
| SMILES | C=C(C)CCC(NC)C1(CC)CCCC1 |
| InChI | InChI=1S/C14H27N/c1-5-14(10-6-7-11-14)13(15-4)9-8-12(2)3/h13,15H,2,5-11H2,1,3-4H3 |
| InChIKey | XPXGZOWTORWEJV-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.38 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|