C14H25BrN4O — CID 105041029
1-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-3-(oxolan-2-yl)propan-1-amine (PubChem CID 105041029) has the molecular formula C14H25BrN4O and a molecular weight of 345.29 g/mol. Its IUPAC name is 1-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-3-(oxolan-2-yl)propan-1-amine.
| Compound Name | 1-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-3-(oxolan-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 105041029 |
| Molecular Formula | C14H25BrN4O |
| Molecular Weight | 345.29 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 1-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-3-(oxolan-2-yl)propan-1-amine |
| SMILES | CN(C)CCn1ncc(Br)c1C(N)CCC1CCCO1 |
| InChI | InChI=1S/C14H25BrN4O/c1-18(2)7-8-19-14(12(15)10-17-19)13(16)6-5-11-4-3-9-20-11/h10-11,13H,3-9,16H2,1-2H3 |
| InChIKey | DCCZDQJPQQKLGT-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 56.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.29 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |