C14H26ClN5O — CID 105335717
2-[4-chloro-5-[1-hydrazinyl-3-(oxolan-2-yl)propyl]pyrazol-1-yl]-N,N-dimethylethanamine (PubChem CID 105335717) has the molecular formula C14H26ClN5O and a molecular weight of 315.85 g/mol. Its IUPAC name is 2-[4-chloro-5-[1-hydrazinyl-3-(oxolan-2-yl)propyl]pyrazol-1-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[4-chloro-5-[1-hydrazinyl-3-(oxolan-2-yl)propyl]pyrazol-1-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 105335717 |
| Molecular Formula | C14H26ClN5O |
| Molecular Weight | 315.85 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 2-[4-chloro-5-[1-hydrazinyl-3-(oxolan-2-yl)propyl]pyrazol-1-yl]-N,N-dimethylethanamine |
| SMILES | CN(C)CCn1ncc(Cl)c1C(CCC1CCCO1)NN |
| InChI | InChI=1S/C14H26ClN5O/c1-19(2)7-8-20-14(12(15)10-17-20)13(18-16)6-5-11-4-3-9-21-11/h10-11,13,18H,3-9,16H2,1-2H3 |
| InChIKey | RUXIAFNBKYAKJS-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.85 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|