C17H24BrN3 — CID 105042151
1-(4-bromo-1-propan-2-ylpyrazol-5-yl)-N-methyl-2-phenylbutan-1-amine (PubChem CID 105042151) has the molecular formula C17H24BrN3 and a molecular weight of 350.30 g/mol. Its IUPAC name is 1-(4-bromo-1-propan-2-ylpyrazol-5-yl)-N-methyl-2-phenylbutan-1-amine.
| Compound Name | 1-(4-bromo-1-propan-2-ylpyrazol-5-yl)-N-methyl-2-phenylbutan-1-amine |
|---|---|
| PubChem CID | 105042151 |
| Molecular Formula | C17H24BrN3 |
| Molecular Weight | 350.30 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 1-(4-bromo-1-propan-2-ylpyrazol-5-yl)-N-methyl-2-phenylbutan-1-amine |
| SMILES | CCC(c1ccccc1)C(NC)c1c(Br)cnn1C(C)C |
| InChI | InChI=1S/C17H24BrN3/c1-5-14(13-9-7-6-8-10-13)16(19-4)17-15(18)11-20-21(17)12(2)3/h6-12,14,16,19H,5H2,1-4H3 |
| InChIKey | JYBMDKBQKJCCMU-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.30 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |