C13H18BrN3S — CID 114649429
1-(4-bromo-1-propan-2-ylpyrazol-5-yl)-N-methyl-2-thiophen-2-ylethanamine (PubChem CID 114649429) has the molecular formula C13H18BrN3S and a molecular weight of 328.28 g/mol. Its IUPAC name is 1-(4-bromo-1-propan-2-ylpyrazol-5-yl)-N-methyl-2-thiophen-2-ylethanamine.
| Compound Name | 1-(4-bromo-1-propan-2-ylpyrazol-5-yl)-N-methyl-2-thiophen-2-ylethanamine |
|---|---|
| PubChem CID | 114649429 |
| Molecular Formula | C13H18BrN3S |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | 1-(4-bromo-1-propan-2-ylpyrazol-5-yl)-N-methyl-2-thiophen-2-ylethanamine |
| SMILES | CNC(Cc1cccs1)c1c(Br)cnn1C(C)C |
| InChI | InChI=1S/C13H18BrN3S/c1-9(2)17-13(11(14)8-16-17)12(15-3)7-10-5-4-6-18-10/h4-6,8-9,12,15H,7H2,1-3H3 |
| InChIKey | RHAOPDCLLHIWOJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |