C15H19BrIN3 — CID 105042306
N-[(4-bromo-1-propan-2-ylpyrazol-5-yl)-(3-iodophenyl)methyl]ethanamine (PubChem CID 105042306) has the molecular formula C15H19BrIN3 and a molecular weight of 448.15 g/mol. Its IUPAC name is N-[(4-bromo-1-propan-2-ylpyrazol-5-yl)-(3-iodophenyl)methyl]ethanamine.
| Compound Name | N-[(4-bromo-1-propan-2-ylpyrazol-5-yl)-(3-iodophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 105042306 |
| Molecular Formula | C15H19BrIN3 |
| Molecular Weight | 448.15 g/mol |
| Exact Mass | 446.98 |
| IUPAC Name | N-[(4-bromo-1-propan-2-ylpyrazol-5-yl)-(3-iodophenyl)methyl]ethanamine |
| SMILES | CCNC(c1cccc(I)c1)c1c(Br)cnn1C(C)C |
| InChI | InChI=1S/C15H19BrIN3/c1-4-18-14(11-6-5-7-12(17)8-11)15-13(16)9-19-20(15)10(2)3/h5-10,14,18H,4H2,1-3H3 |
| InChIKey | MKBOUDZLTDGUGY-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.15 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|