C16H22BrN3O — CID 114647731
N-[[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-(3-methylphenyl)methyl]ethanamine (PubChem CID 114647731) has the molecular formula C16H22BrN3O and a molecular weight of 352.28 g/mol. Its IUPAC name is N-[[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-(3-methylphenyl)methyl]ethanamine.
| Compound Name | N-[[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-(3-methylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 114647731 |
| Molecular Formula | C16H22BrN3O |
| Molecular Weight | 352.28 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | N-[[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-(3-methylphenyl)methyl]ethanamine |
| SMILES | CCNC(c1cccc(C)c1)c1c(Br)cnn1CCOC |
| InChI | InChI=1S/C16H22BrN3O/c1-4-18-15(13-7-5-6-12(2)10-13)16-14(17)11-19-20(16)8-9-21-3/h5-7,10-11,15,18H,4,8-9H2,1-3H3 |
| InChIKey | XPEPDJPELQIODW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.28 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |