C14H17Br2N3O — CID 114647389
1-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-1-(3-bromophenyl)-N-methylmethanamine (PubChem CID 114647389) has the molecular formula C14H17Br2N3O and a molecular weight of 403.12 g/mol. Its IUPAC name is 1-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-1-(3-bromophenyl)-N-methylmethanamine.
| Compound Name | 1-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-1-(3-bromophenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 114647389 |
| Molecular Formula | C14H17Br2N3O |
| Molecular Weight | 403.12 g/mol |
| Exact Mass | 400.97 |
| IUPAC Name | 1-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-1-(3-bromophenyl)-N-methylmethanamine |
| SMILES | CNC(c1cccc(Br)c1)c1c(Br)cnn1CCOC |
| InChI | InChI=1S/C14H17Br2N3O/c1-17-13(10-4-3-5-11(15)8-10)14-12(16)9-18-19(14)6-7-20-2/h3-5,8-9,13,17H,6-7H2,1-2H3 |
| InChIKey | AGHJGMZYAYKJBM-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.12 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |