C12H15Br2N3OS — CID 105184314
1-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-1-(5-bromothiophen-3-yl)-N-methylmethanamine (PubChem CID 105184314) has the molecular formula C12H15Br2N3OS and a molecular weight of 409.15 g/mol. Its IUPAC name is 1-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-1-(5-bromothiophen-3-yl)-N-methylmethanamine.
| Compound Name | 1-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-1-(5-bromothiophen-3-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 105184314 |
| Molecular Formula | C12H15Br2N3OS |
| Molecular Weight | 409.15 g/mol |
| Exact Mass | 406.93 |
| IUPAC Name | 1-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-1-(5-bromothiophen-3-yl)-N-methylmethanamine |
| SMILES | CNC(c1csc(Br)c1)c1c(Br)cnn1CCOC |
| InChI | InChI=1S/C12H15Br2N3OS/c1-15-11(8-5-10(14)19-7-8)12-9(13)6-16-17(12)3-4-18-2/h5-7,11,15H,3-4H2,1-2H3 |
| InChIKey | KSKOFSONIUFHOZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.15 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |