C15H18BrClFN3 — CID 105042540
N-[(2-bromo-4-fluorophenyl)-(4-chloro-1-propylpyrazol-5-yl)methyl]ethanamine (PubChem CID 105042540) has the molecular formula C15H18BrClFN3 and a molecular weight of 374.69 g/mol. Its IUPAC name is N-[(2-bromo-4-fluorophenyl)-(4-chloro-1-propylpyrazol-5-yl)methyl]ethanamine.
| Compound Name | N-[(2-bromo-4-fluorophenyl)-(4-chloro-1-propylpyrazol-5-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 105042540 |
| Molecular Formula | C15H18BrClFN3 |
| Molecular Weight | 374.69 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | N-[(2-bromo-4-fluorophenyl)-(4-chloro-1-propylpyrazol-5-yl)methyl]ethanamine |
| SMILES | CCCn1ncc(Cl)c1C(NCC)c1ccc(F)cc1Br |
| InChI | InChI=1S/C15H18BrClFN3/c1-3-7-21-15(13(17)9-20-21)14(19-4-2)11-6-5-10(18)8-12(11)16/h5-6,8-9,14,19H,3-4,7H2,1-2H3 |
| InChIKey | KXDSUMDPHPEPRV-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.69 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |